C32H28N4 — CID 166987238
1-N,1-N'-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]ethene-1,1-diamine (PubChem CID 166987238) has the molecular formula C32H28N4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-N,1-N'-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]ethene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]ethene-1,1-diamine |
|---|---|
| PubChem CID | 166987238 |
| Molecular Formula | C32H28N4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-N,1-N'-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]ethene-1,1-diamine |
| SMILES | C=C(N/N=C/C(=C/c1ccccc1)c1ccccc1)N/N=C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H28N4/c1-26(35-33-24-31(29-18-10-4-11-19-29)22-27-14-6-2-7-15-27)36-34-25-32(30-20-12-5-13-21-30)23-28-16-8-3-9-17-28/h2-25,35-36H,1H2/b31-22-,32-23-,33-24+,34-25+ |
| InChIKey | JFYBVYMBYJSPKB-OKLKHNCUSA-N |
| XLogP | 7.09 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|