C29H26N2 — CID 91118877
N-[(Z)-3,3-bis(4-methylphenyl)prop-2-enylideneamino]-N-phenylaniline (PubChem CID 91118877) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[(Z)-3,3-bis(4-methylphenyl)prop-2-enylideneamino]-N-phenylaniline.
| Compound Name | N-[(Z)-3,3-bis(4-methylphenyl)prop-2-enylideneamino]-N-phenylaniline |
|---|---|
| PubChem CID | 91118877 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(Z)-3,3-bis(4-methylphenyl)prop-2-enylideneamino]-N-phenylaniline |
| SMILES | Cc1ccc(C(=C/C=N\N(c2ccccc2)c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H26N2/c1-23-13-17-25(18-14-23)29(26-19-15-24(2)16-20-26)21-22-30-31(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-22H,1-2H3/b30-22- |
| InChIKey | SVOSTHFHVWFELT-SWKFRHMKSA-N |
| XLogP | 7.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|