C28H24N2O — CID 22828689
N-[(E)-[(Z)-3-(4-methoxyphenyl)-3-phenylprop-2-enylidene]amino]-N-phenylaniline (PubChem CID 22828689) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(E)-[(Z)-3-(4-methoxyphenyl)-3-phenylprop-2-enylidene]amino]-N-phenylaniline.
| Compound Name | N-[(E)-[(Z)-3-(4-methoxyphenyl)-3-phenylprop-2-enylidene]amino]-N-phenylaniline |
|---|---|
| PubChem CID | 22828689 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[(E)-[(Z)-3-(4-methoxyphenyl)-3-phenylprop-2-enylidene]amino]-N-phenylaniline |
| SMILES | COc1ccc(/C(=C\C=N\N(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O/c1-31-27-19-17-24(18-20-27)28(23-11-5-2-6-12-23)21-22-29-30(25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-22H,1H3/b28-21-,29-22+ |
| InChIKey | GGLRIPITHXQFGB-FJYRUYPUSA-N |
| XLogP | 6.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|