C44H42N2 — CID 140711458
3-(9-tert-butylcarbazol-3-yl)-N-[(2Z,5E)-5-methyl-4-methylideneocta-2,5,7-trienyl]-N-(4-phenylphenyl)aniline (PubChem CID 140711458) has the molecular formula C44H42N2 and a molecular weight of 598.83 g/mol. Its IUPAC name is 3-(9-tert-butylcarbazol-3-yl)-N-[(2Z,5E)-5-methyl-4-methylideneocta-2,5,7-trienyl]-N-(4-phenylphenyl)aniline.
| Compound Name | 3-(9-tert-butylcarbazol-3-yl)-N-[(2Z,5E)-5-methyl-4-methylideneocta-2,5,7-trienyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 140711458 |
| Molecular Formula | C44H42N2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 3-(9-tert-butylcarbazol-3-yl)-N-[(2Z,5E)-5-methyl-4-methylideneocta-2,5,7-trienyl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C)C(=C)/C=C\CN(c1ccc(-c2ccccc2)cc1)c1cccc(-c2ccc3c(c2)c2ccccc2n3C(C)(C)C)c1 |
| InChI | InChI=1S/C44H42N2/c1-7-15-32(2)33(3)16-14-29-45(38-26-23-35(24-27-38)34-17-9-8-10-18-34)39-20-13-19-36(30-39)37-25-28-43-41(31-37)40-21-11-12-22-42(40)46(43)44(4,5)6/h7-28,30-31H,1,3,29H2,2,4-6H3/b16-14-,32-15+ |
| InChIKey | YMLDMRPANYTEEH-PNIDQBOISA-N |
| XLogP | 12.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|