C36H28N2 — CID 144858517
9-[4-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]phenyl]-2,3-dihydrocarbazole (PubChem CID 144858517) has the molecular formula C36H28N2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 9-[4-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]phenyl]-2,3-dihydrocarbazole.
| Compound Name | 9-[4-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]phenyl]-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 144858517 |
| Molecular Formula | C36H28N2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 9-[4-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]phenyl]-2,3-dihydrocarbazole |
| SMILES | C=Cc1c(C=C)n(-c2ccc(-c3ccc(-n4c5c(c6ccccc64)=CCCC=5)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C36H28N2/c1-3-29-30-11-5-8-14-34(30)37(33(29)4-2)27-21-17-25(18-22-27)26-19-23-28(24-20-26)38-35-15-9-6-12-31(35)32-13-7-10-16-36(32)38/h3-6,8-9,11-24H,1-2,7,10H2 |
| InChIKey | GRYBDHIEEVLNKE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |