About 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole
9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole (PubChem CID 89208742) has the molecular formula C33H30N2
and a molecular weight of 454.62 g/mol. Its IUPAC name is 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole.
Molecular Properties
| Compound Name | 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole |
| PubChem CID | 89208742 |
| Molecular Formula | C33H30N2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole |
| SMILES | C=Cc1c(/C=C\CC)n(-c2ccccc2-n2c3c(c4cc(C)ccc42)=CCCC=3)c2ccccc12 |
| InChI | InChI=1S/C33H30N2/c1-4-6-15-28-24(5-2)25-13-7-9-16-29(25)34(28)32-18-11-12-19-33(32)35-30-17-10-8-14-26(30)27-22-23(3)20-21-31(27)35/h5-7,9,11-22H,2,4,8,10H2,1,3H3/b15-6- |
| InChIKey | XPSYCFRTCAXNBM-UUASQNMZSA-N |
| XLogP | 7.30 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole?
The IUPAC name of 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole (CID 89208742) is 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole.
What is the SMILES notation for 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole?
The canonical SMILES for 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole is C=Cc1c(/C=C\CC)n(-c2ccccc2-n2c3c(c4cc(C)ccc42)=CCCC=3)c2ccccc12.
What is the InChIKey of 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole?
The InChIKey is XPSYCFRTCAXNBM-UUASQNMZSA-N. The full InChI is InChI=1S/C33H30N2/c1-4-6-15-28-24(5-2)25-13-7-9-16-29(25)34(28)32-18-11-12-19-33(32)35-30-17-10-8-14-26(30)27-22-23(3)20-21-31(27)35/h5-7,9,11-22H,2,4,8,10H2,1,3H3/b15-6-.
What are the key properties of 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole?
9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole has a molecular weight of 454.62 g/mol, XLogP of 7.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-[2-[(Z)-but-1-enyl]-3-ethenylindol-1-yl]phenyl]-6-methyl-2,3-dihydrocarbazole is sourced from PubChem (CID 89208742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).