C22H23N — CID 142430269
2-ethenyl-1-(5-ethyl-2-methylphenyl)-3-[(Z)-prop-1-enyl]indole (PubChem CID 142430269) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-ethenyl-1-(5-ethyl-2-methylphenyl)-3-[(Z)-prop-1-enyl]indole.
| Compound Name | 2-ethenyl-1-(5-ethyl-2-methylphenyl)-3-[(Z)-prop-1-enyl]indole |
|---|---|
| PubChem CID | 142430269 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-ethenyl-1-(5-ethyl-2-methylphenyl)-3-[(Z)-prop-1-enyl]indole |
| SMILES | C=Cc1c(/C=C\C)c2ccccc2n1-c1cc(CC)ccc1C |
| InChI | InChI=1S/C22H23N/c1-5-10-18-19-11-8-9-12-21(19)23(20(18)7-3)22-15-17(6-2)14-13-16(22)4/h5,7-15H,3,6H2,1-2,4H3/b10-5- |
| InChIKey | LCYKGWQBRRTEIU-YHYXMXQVSA-N |
| XLogP | 6.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |