C39H33N3 — CID 142501841
9-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-5-methyl-2-(3-methylphenyl)phenyl]carbazol-2-amine (PubChem CID 142501841) has the molecular formula C39H33N3 and a molecular weight of 543.71 g/mol. Its IUPAC name is 9-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-5-methyl-2-(3-methylphenyl)phenyl]carbazol-2-amine.
| Compound Name | 9-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-5-methyl-2-(3-methylphenyl)phenyl]carbazol-2-amine |
|---|---|
| PubChem CID | 142501841 |
| Molecular Formula | C39H33N3 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 9-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-5-methyl-2-(3-methylphenyl)phenyl]carbazol-2-amine |
| SMILES | C=Cc1c(/C=C\C)n(-c2cc(-c3cccc(C)c3)c(-n3c4ccccc4c4ccc(N)cc43)cc2C)c2ccccc12 |
| InChI | InChI=1S/C39H33N3/c1-5-12-34-29(6-2)30-15-7-9-17-35(30)41(34)37-24-33(27-14-11-13-25(3)21-27)38(22-26(37)4)42-36-18-10-8-16-31(36)32-20-19-28(40)23-39(32)42/h5-24H,2,40H2,1,3-4H3/b12-5- |
| InChIKey | YTZZIJHDMFYVOS-XGICHPGQSA-N |
| XLogP | 10.27 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|