C49H41N3 — CID 144725826
14-ethenyl-9-(4-methylphenyl)-13-[(Z)-prop-1-enyl]-9-azahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3,5,7,10,13,15,17,19,21-decaene;(Z)-3-imino-1,3-diphenylprop-1-en-1-amine (PubChem CID 144725826) has the molecular formula C49H41N3 and a molecular weight of 671.89 g/mol. Its IUPAC name is 14-ethenyl-9-(4-methylphenyl)-13-[(Z)-prop-1-enyl]-9-azahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3,5,7,10,13,15,17,19,21-decaene;(Z)-3-imino-1,3-diphenylprop-1-en-1-amine.
| Compound Name | 14-ethenyl-9-(4-methylphenyl)-13-[(Z)-prop-1-enyl]-9-azahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3,5,7,10,13,15,17,19,21-decaene;(Z)-3-imino-1,3-diphenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 144725826 |
| Molecular Formula | C49H41N3 |
| Molecular Weight | 671.89 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 14-ethenyl-9-(4-methylphenyl)-13-[(Z)-prop-1-enyl]-9-azahexacyclo[14.7.0.02,10.03,8.011,15.017,22]tricosa-1,3,5,7,10,13,15,17,19,21-decaene;(Z)-3-imino-1,3-diphenylprop-1-en-1-amine |
| SMILES | C=CC1=C(/C=C\C)Cc2c1c1c(c3c4ccccc4n(-c4ccc(C)cc4)c23)Cc2ccccc2-1.[H]/N=C(/C=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H27N.C15H14N2/c1-4-10-22-20-29-31(25(22)5-2)32-26-12-7-6-11-23(26)19-28(32)33-27-13-8-9-14-30(27)35(34(29)33)24-17-15-21(3)16-18-24;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h4-18H,2,19-20H2,1,3H3;1-11,16H,17H2/b10-4-;15-11-,16-14- |
| InChIKey | JCYDFLPWOGXMTB-CGUKSZDXSA-N |
| XLogP | 11.79 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.89 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|