C48H42N4O — CID 145083062
6-[4-[(Z)-3-amino-3-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]prop-2-enimidoyl]phenyl]-N-(2-ethenyl-4-methylphenyl)dibenzofuran-2-amine;toluene (PubChem CID 145083062) has the molecular formula C48H42N4O and a molecular weight of 690.89 g/mol. Its IUPAC name is 6-[4-[(Z)-3-amino-3-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]prop-2-enimidoyl]phenyl]-N-(2-ethenyl-4-methylphenyl)dibenzofuran-2-amine;toluene.
| Compound Name | 6-[4-[(Z)-3-amino-3-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]prop-2-enimidoyl]phenyl]-N-(2-ethenyl-4-methylphenyl)dibenzofuran-2-amine;toluene |
|---|---|
| PubChem CID | 145083062 |
| Molecular Formula | C48H42N4O |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | 6-[4-[(Z)-3-amino-3-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]prop-2-enimidoyl]phenyl]-N-(2-ethenyl-4-methylphenyl)dibenzofuran-2-amine;toluene |
| SMILES | Cc1ccccc1.[H]/N=C/C=C\C(=C)c1ccc(/C(N)=C/C(=N\[H])c2ccc(-c3cccc4c3oc3ccc(Nc5ccc(C)cc5C=C)cc34)cc2)cc1 |
| InChI | InChI=1S/C41H34N4O.C7H8/c1-4-28-23-26(2)10-20-39(28)45-33-19-21-40-36(24-33)35-9-5-8-34(41(35)46-40)30-13-17-32(18-14-30)38(44)25-37(43)31-15-11-29(12-16-31)27(3)7-6-22-42;1-7-5-3-2-4-6-7/h4-25,42,44-45H,1,3,43H2,2H3;2-6H,1H3/b7-6-,37-25-,42-22+,44-38+; |
| InChIKey | JBNROSJBAFZXFF-BNVXMASCSA-N |
| XLogP | 12.53 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|