C60H43N3O2 — CID 143904594
2-[3-[3-[(Z,3E)-3-hydrazinylidene-1,3-diphenylprop-1-enyl]phenyl]phenyl]-6-[3-[(Z)-3-imino-1,3-diphenylprop-1-enyl]phenyl]dibenzofuran-3-ol (PubChem CID 143904594) has the molecular formula C60H43N3O2 and a molecular weight of 838.02 g/mol. Its IUPAC name is 2-[3-[3-[(Z,3E)-3-hydrazinylidene-1,3-diphenylprop-1-enyl]phenyl]phenyl]-6-[3-[(Z)-3-imino-1,3-diphenylprop-1-enyl]phenyl]dibenzofuran-3-ol.
| Compound Name | 2-[3-[3-[(Z,3E)-3-hydrazinylidene-1,3-diphenylprop-1-enyl]phenyl]phenyl]-6-[3-[(Z)-3-imino-1,3-diphenylprop-1-enyl]phenyl]dibenzofuran-3-ol |
|---|---|
| PubChem CID | 143904594 |
| Molecular Formula | C60H43N3O2 |
| Molecular Weight | 838.02 g/mol |
| Exact Mass | 837.34 |
| IUPAC Name | 2-[3-[3-[(Z,3E)-3-hydrazinylidene-1,3-diphenylprop-1-enyl]phenyl]phenyl]-6-[3-[(Z)-3-imino-1,3-diphenylprop-1-enyl]phenyl]dibenzofuran-3-ol |
| SMILES | [H]/N=C(/C=C(/c1ccccc1)c1cccc(-c2cccc3c2oc2cc(O)c(-c4cccc(-c5cccc(/C(=C\C(=N/N)c6ccccc6)c6ccccc6)c5)c4)cc23)c1)c1ccccc1 |
| InChI | InChI=1S/C60H43N3O2/c61-56(42-21-9-3-10-22-42)37-52(40-17-5-1-6-18-40)48-29-15-27-46(35-48)50-31-16-32-51-55-36-54(58(64)39-59(55)65-60(50)51)49-30-14-26-45(34-49)44-25-13-28-47(33-44)53(41-19-7-2-8-20-41)38-57(63-62)43-23-11-4-12-24-43/h1-39,61,64H,62H2/b52-37-,53-38-,61-56-,63-57+ |
| InChIKey | XLMMVRMYYVUTFF-FFFAGQTJSA-N |
| XLogP | 14.59 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.02 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|