C43H32N4O — CID 145083007
3,4-bis(ethenyl)-N'-[4-[6-(5-methylindol-1-yl)dibenzofuran-2-yl]benzenecarboximidoyl]naphthalene-1-carboximidamide (PubChem CID 145083007) has the molecular formula C43H32N4O and a molecular weight of 620.76 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-N'-[4-[6-(5-methylindol-1-yl)dibenzofuran-2-yl]benzenecarboximidoyl]naphthalene-1-carboximidamide.
| Compound Name | 3,4-bis(ethenyl)-N'-[4-[6-(5-methylindol-1-yl)dibenzofuran-2-yl]benzenecarboximidoyl]naphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 145083007 |
| Molecular Formula | C43H32N4O |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 3,4-bis(ethenyl)-N'-[4-[6-(5-methylindol-1-yl)dibenzofuran-2-yl]benzenecarboximidoyl]naphthalene-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1cc(C=C)c(C=C)c2ccccc12)c1ccc(-c2ccc3oc4c(-n5ccc6cc(C)ccc65)cccc4c3c2)cc1 |
| InChI | InChI=1S/C43H32N4O/c1-4-27-24-37(34-10-7-6-9-33(34)32(27)5-2)43(45)46-42(44)29-16-14-28(15-17-29)30-18-20-40-36(25-30)35-11-8-12-39(41(35)48-40)47-22-21-31-23-26(3)13-19-38(31)47/h4-25H,1-2H2,3H3,(H3,44,45,46) |
| InChIKey | XEJOWKYOBOZGIW-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|