C48H40N4S — CID 145083008
1-[8-[4-[(Z)-3-amino-3-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]prop-2-enimidoyl]phenyl]dibenzothiophen-4-yl]indol-5-amine;toluene (PubChem CID 145083008) has the molecular formula C48H40N4S and a molecular weight of 704.94 g/mol. Its IUPAC name is 1-[8-[4-[(Z)-3-amino-3-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]prop-2-enimidoyl]phenyl]dibenzothiophen-4-yl]indol-5-amine;toluene.
| Compound Name | 1-[8-[4-[(Z)-3-amino-3-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]prop-2-enimidoyl]phenyl]dibenzothiophen-4-yl]indol-5-amine;toluene |
|---|---|
| PubChem CID | 145083008 |
| Molecular Formula | C48H40N4S |
| Molecular Weight | 704.94 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | 1-[8-[4-[(Z)-3-amino-3-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]prop-2-enimidoyl]phenyl]dibenzothiophen-4-yl]indol-5-amine;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\C=C(/N)c1cccc(/C(C=C)=C/C=C)c1)c1ccc(-c2ccc3sc4c(-n5ccc6cc(N)ccc65)cccc4c3c2)cc1 |
| InChI | InChI=1S/C41H32N4S.C7H8/c1-3-7-26(4-2)29-8-5-9-31(22-29)37(44)25-36(43)28-14-12-27(13-15-28)30-16-19-40-35(24-30)34-10-6-11-39(41(34)46-40)45-21-20-32-23-33(42)17-18-38(32)45;1-7-5-3-2-4-6-7/h3-25,43H,1-2,42,44H2;2-6H,1H3/b26-7+,37-25-,43-36+; |
| InChIKey | YHTYORNHJILLAH-ZDHKXPPPSA-N |
| XLogP | 12.37 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.94 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|