C44H38N4O — CID 145083143
1-[8-[(Z)-3-amino-3-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]prop-2-enimidoyl]dibenzofuran-2-yl]indole-5-carbonitrile;toluene (PubChem CID 145083143) has the molecular formula C44H38N4O and a molecular weight of 638.82 g/mol. Its IUPAC name is 1-[8-[(Z)-3-amino-3-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]prop-2-enimidoyl]dibenzofuran-2-yl]indole-5-carbonitrile;toluene.
| Compound Name | 1-[8-[(Z)-3-amino-3-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]prop-2-enimidoyl]dibenzofuran-2-yl]indole-5-carbonitrile;toluene |
|---|---|
| PubChem CID | 145083143 |
| Molecular Formula | C44H38N4O |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 1-[8-[(Z)-3-amino-3-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]prop-2-enimidoyl]dibenzofuran-2-yl]indole-5-carbonitrile;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\C=C(/N)c1ccc(C(/C=C\C)=C/CC)cc1)c1ccc2oc3ccc(-n4ccc5cc(C#N)ccc54)cc3c2c1 |
| InChI | InChI=1S/C37H30N4O.C7H8/c1-3-5-25(6-4-2)26-8-10-27(11-9-26)33(39)22-34(40)28-12-15-36-31(20-28)32-21-30(13-16-37(32)42-36)41-18-17-29-19-24(23-38)7-14-35(29)41;1-7-5-3-2-4-6-7/h3,5-22,40H,4,39H2,1-2H3;2-6H,1H3/b5-3-,25-6+,33-22-,40-34+; |
| InChIKey | VNVVRHRQQAOTOY-NRJIHYCSSA-N |
| XLogP | 11.13 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|