C45H39N3O — CID 142481954
4-(3-methylphenyl)-6-phenyldibenzofuran;4-phenylbenzenecarboximidamide;phenylmethanamine (PubChem CID 142481954) has the molecular formula C45H39N3O and a molecular weight of 637.83 g/mol. Its IUPAC name is 4-(3-methylphenyl)-6-phenyldibenzofuran;4-phenylbenzenecarboximidamide;phenylmethanamine.
| Compound Name | 4-(3-methylphenyl)-6-phenyldibenzofuran;4-phenylbenzenecarboximidamide;phenylmethanamine |
|---|---|
| PubChem CID | 142481954 |
| Molecular Formula | C45H39N3O |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 4-(3-methylphenyl)-6-phenyldibenzofuran;4-phenylbenzenecarboximidamide;phenylmethanamine |
| SMILES | Cc1cccc(-c2cccc3c2oc2c(-c4ccccc4)cccc23)c1.NCc1ccccc1.[H]/N=C(\N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18O.C13H12N2.C7H9N/c1-17-8-5-11-19(16-17)21-13-7-15-23-22-14-6-12-20(24(22)26-25(21)23)18-9-3-2-4-10-18;14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;8-6-7-4-2-1-3-5-7/h2-16H,1H3;1-9H,(H3,14,15);1-5H,6,8H2 |
| InChIKey | JJCYZGCILIXYKK-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|