C18H17NOS2 — CID 54035615
3-methylsulfanyl-N-(1-phenylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 54035615) has the molecular formula C18H17NOS2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-methylsulfanyl-N-(1-phenylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-methylsulfanyl-N-(1-phenylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 54035615 |
| Molecular Formula | C18H17NOS2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-methylsulfanyl-N-(1-phenylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CSc1c(C(=O)NC(C)c2ccccc2)sc2ccccc12 |
| InChI | InChI=1S/C18H17NOS2/c1-12(13-8-4-3-5-9-13)19-18(20)17-16(21-2)14-10-6-7-11-15(14)22-17/h3-12H,1-2H3,(H,19,20) |
| InChIKey | LISOHGKJSVTXJS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |