C20H20N2O3S — CID 58306773
methyl 4-[(1S)-1-[[3-(methylamino)-1-benzothiophene-2-carbonyl]amino]ethyl]benzoate (PubChem CID 58306773) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[3-(methylamino)-1-benzothiophene-2-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[3-(methylamino)-1-benzothiophene-2-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 58306773 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl 4-[(1S)-1-[[3-(methylamino)-1-benzothiophene-2-carbonyl]amino]ethyl]benzoate |
| SMILES | CNc1c(C(=O)N[C@@H](C)c2ccc(C(=O)OC)cc2)sc2ccccc12 |
| InChI | InChI=1S/C20H20N2O3S/c1-12(13-8-10-14(11-9-13)20(24)25-3)22-19(23)18-17(21-2)15-6-4-5-7-16(15)26-18/h4-12,21H,1-3H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | ZIWKILQRCYAMGA-LBPRGKRZSA-N |
| XLogP | 4.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |