C16H18N2O3S — CID 58125365
methyl 4-[(1S)-1-[[3-(methylamino)thiophene-2-carbonyl]amino]ethyl]benzoate (PubChem CID 58125365) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[3-(methylamino)thiophene-2-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[3-(methylamino)thiophene-2-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 58125365 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | methyl 4-[(1S)-1-[[3-(methylamino)thiophene-2-carbonyl]amino]ethyl]benzoate |
| SMILES | CNc1ccsc1C(=O)N[C@@H](C)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C16H18N2O3S/c1-10(11-4-6-12(7-5-11)16(20)21-3)18-15(19)14-13(17-2)8-9-22-14/h4-10,17H,1-3H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | WRXWIJONTVFWST-JTQLQIEISA-N |
| XLogP | 3.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |