C15H14N2O4S — CID 7167229
methyl 4-[[3-(methylcarbamoyl)thiophen-2-yl]carbamoyl]benzoate (PubChem CID 7167229) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 4-[[3-(methylcarbamoyl)thiophen-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(methylcarbamoyl)thiophen-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 7167229 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methyl 4-[[3-(methylcarbamoyl)thiophen-2-yl]carbamoyl]benzoate |
| SMILES | CNC(=O)c1ccsc1NC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-16-13(19)11-7-8-22-14(11)17-12(18)9-3-5-10(6-4-9)15(20)21-2/h3-8H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | PMOXLAPHHNIFKI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |