C15H16N2O4S — CID 5228480
2-[(2,4-dimethoxybenzoyl)amino]-N-methylthiophene-3-carboxamide (PubChem CID 5228480) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[(2,4-dimethoxybenzoyl)amino]-N-methylthiophene-3-carboxamide.
| Compound Name | 2-[(2,4-dimethoxybenzoyl)amino]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 5228480 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[(2,4-dimethoxybenzoyl)amino]-N-methylthiophene-3-carboxamide |
| SMILES | CNC(=O)c1ccsc1NC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H16N2O4S/c1-16-13(18)11-6-7-22-15(11)17-14(19)10-5-4-9(20-2)8-12(10)21-3/h4-8H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | YCUALIDZZGYQDQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |