C13H11FN2O2S — CID 7164117
2-[(3-fluorobenzoyl)amino]-N-methylthiophene-3-carboxamide (PubChem CID 7164117) has the molecular formula C13H11FN2O2S and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-N-methylthiophene-3-carboxamide.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 7164117 |
| Molecular Formula | C13H11FN2O2S |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-N-methylthiophene-3-carboxamide |
| SMILES | CNC(=O)c1ccsc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H11FN2O2S/c1-15-12(18)10-5-6-19-13(10)16-11(17)8-3-2-4-9(14)7-8/h2-7H,1H3,(H,15,18)(H,16,17) |
| InChIKey | IPYPFCZHNASNST-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |