C19H16ClN3O4S2 — CID 16803047
2-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]-N-methylthiophene-3-carboxamide (PubChem CID 16803047) has the molecular formula C19H16ClN3O4S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]-N-methylthiophene-3-carboxamide.
| Compound Name | 2-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 16803047 |
| Molecular Formula | C19H16ClN3O4S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 2-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]-N-methylthiophene-3-carboxamide |
| SMILES | CNC(=O)c1ccsc1NC(=O)c1cccc(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H16ClN3O4S2/c1-21-18(25)16-9-10-28-19(16)22-17(24)12-3-2-4-14(11-12)23-29(26,27)15-7-5-13(20)6-8-15/h2-11,23H,1H3,(H,21,25)(H,22,24) |
| InChIKey | XWYTWIBERSQJTC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |