C15H21ClN2O4 — CID 163364958
methyl 4-[(1S)-1-[(3-aminooxolane-3-carbonyl)amino]ethyl]benzoate;hydrochloride (PubChem CID 163364958) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[(3-aminooxolane-3-carbonyl)amino]ethyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[(1S)-1-[(3-aminooxolane-3-carbonyl)amino]ethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 163364958 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl 4-[(1S)-1-[(3-aminooxolane-3-carbonyl)amino]ethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc([C@H](C)NC(=O)C2(N)CCOC2)cc1.Cl |
| InChI | InChI=1S/C15H20N2O4.ClH/c1-10(17-14(19)15(16)7-8-21-9-15)11-3-5-12(6-4-11)13(18)20-2;/h3-6,10H,7-9,16H2,1-2H3,(H,17,19);1H/t10-,15?;/m0./s1 |
| InChIKey | GWFQJESYBCCGFB-NAUAYZBBSA-N |
| XLogP | 1.19 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |