C11H16N2O2S — CID 64892097
3-amino-N-(1-thiophen-2-ylethyl)oxolane-3-carboxamide (PubChem CID 64892097) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-amino-N-(1-thiophen-2-ylethyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(1-thiophen-2-ylethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 64892097 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-amino-N-(1-thiophen-2-ylethyl)oxolane-3-carboxamide |
| SMILES | CC(NC(=O)C1(N)CCOC1)c1cccs1 |
| InChI | InChI=1S/C11H16N2O2S/c1-8(9-3-2-6-16-9)13-10(14)11(12)4-5-15-7-11/h2-3,6,8H,4-5,7,12H2,1H3,(H,13,14) |
| InChIKey | CZLBARXIKRVIHI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |