C14H19FN2O2 — CID 115295213
4-amino-N-[(1S)-1-(4-fluorophenyl)ethyl]oxane-4-carboxamide (PubChem CID 115295213) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-amino-N-[(1S)-1-(4-fluorophenyl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-amino-N-[(1S)-1-(4-fluorophenyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 115295213 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-amino-N-[(1S)-1-(4-fluorophenyl)ethyl]oxane-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1(N)CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O2/c1-10(11-2-4-12(15)5-3-11)17-13(18)14(16)6-8-19-9-7-14/h2-5,10H,6-9,16H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | JUXOZIQUDSGDJT-JTQLQIEISA-N |
| XLogP | 1.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |