C15H21BrN2O3 — CID 115294053
4-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]oxane-4-carboxamide (PubChem CID 115294053) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 4-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 115294053 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]oxane-4-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)C2(N)CCOCC2)cc1Br |
| InChI | InChI=1S/C15H21BrN2O3/c1-10(11-3-4-13(20-2)12(16)9-11)18-14(19)15(17)5-7-21-8-6-15/h3-4,9-10H,5-8,17H2,1-2H3,(H,18,19) |
| InChIKey | JFINCYWNRASNFY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |