C22H25NO4S — CID 55748601
N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 55748601) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55748601 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)c2sc3ccccc3c2C)cc1OC |
| InChI | InChI=1S/C22H25NO4S/c1-14-17-7-5-6-8-20(17)28-21(14)22(24)23-15(2)16-9-10-18(19(13-16)26-4)27-12-11-25-3/h5-10,13,15H,11-12H2,1-4H3,(H,23,24) |
| InChIKey | VGRIMFYEKCDJQI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|