C28H30N2O4 — CID 55972027
1-benzyl-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]indole-3-carboxamide (PubChem CID 55972027) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-benzyl-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]indole-3-carboxamide.
| Compound Name | 1-benzyl-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 55972027 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-benzyl-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]indole-3-carboxamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)c2cn(Cc3ccccc3)c3ccccc23)cc1OC |
| InChI | InChI=1S/C28H30N2O4/c1-20(22-13-14-26(27(17-22)33-3)34-16-15-32-2)29-28(31)24-19-30(18-21-9-5-4-6-10-21)25-12-8-7-11-23(24)25/h4-14,17,19-20H,15-16,18H2,1-3H3,(H,29,31) |
| InChIKey | AUECLQCKJNSVGS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|