C21H24O3 — CID 142924740
3,5-dimethoxy-2-(2-methylnaphthalen-1-yl)phenol;ethane (PubChem CID 142924740) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3,5-dimethoxy-2-(2-methylnaphthalen-1-yl)phenol;ethane.
| Compound Name | 3,5-dimethoxy-2-(2-methylnaphthalen-1-yl)phenol;ethane |
|---|---|
| PubChem CID | 142924740 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3,5-dimethoxy-2-(2-methylnaphthalen-1-yl)phenol;ethane |
| SMILES | CC.COc1cc(O)c(-c2c(C)ccc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C19H18O3.C2H6/c1-12-8-9-13-6-4-5-7-15(13)18(12)19-16(20)10-14(21-2)11-17(19)22-3;1-2/h4-11,20H,1-3H3;1-2H3 |
| InChIKey | HNZYUMNWRSQCSQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |