C20H20O3 — CID 15130773
1-(2,5-dimethoxy-3,4-dimethylphenyl)naphthalen-2-ol (PubChem CID 15130773) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-3,4-dimethylphenyl)naphthalen-2-ol.
| Compound Name | 1-(2,5-dimethoxy-3,4-dimethylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 15130773 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-(2,5-dimethoxy-3,4-dimethylphenyl)naphthalen-2-ol |
| SMILES | COc1cc(-c2c(O)ccc3ccccc23)c(OC)c(C)c1C |
| InChI | InChI=1S/C20H20O3/c1-12-13(2)20(23-4)16(11-18(12)22-3)19-15-8-6-5-7-14(15)9-10-17(19)21/h5-11,21H,1-4H3 |
| InChIKey | YWSDQTQRQKTOBM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |