C19H20O3 — CID 144695247
ethane;1-(2-hydroxy-3-methoxyphenyl)naphthalen-2-ol (PubChem CID 144695247) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethane;1-(2-hydroxy-3-methoxyphenyl)naphthalen-2-ol.
| Compound Name | ethane;1-(2-hydroxy-3-methoxyphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 144695247 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethane;1-(2-hydroxy-3-methoxyphenyl)naphthalen-2-ol |
| SMILES | CC.COc1cccc(-c2c(O)ccc3ccccc23)c1O |
| InChI | InChI=1S/C17H14O3.C2H6/c1-20-15-8-4-7-13(17(15)19)16-12-6-3-2-5-11(12)9-10-14(16)18;1-2/h2-10,18-19H,1H3;1-2H3 |
| InChIKey | RCJOBXHURYSZLM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |