C18H15FO2 — CID 130198538
1-(2,4-dimethoxyphenyl)-2-fluoronaphthalene (PubChem CID 130198538) has the molecular formula C18H15FO2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-fluoronaphthalene.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-fluoronaphthalene |
|---|---|
| PubChem CID | 130198538 |
| Molecular Formula | C18H15FO2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-fluoronaphthalene |
| SMILES | COc1ccc(-c2c(F)ccc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C18H15FO2/c1-20-13-8-9-15(17(11-13)21-2)18-14-6-4-3-5-12(14)7-10-16(18)19/h3-11H,1-2H3 |
| InChIKey | CURGBHSIQAADIC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |