C14H12ClFO2 — CID 146431475
1-chloro-2-(2,4-dimethoxyphenyl)-3-fluorobenzene (PubChem CID 146431475) has the molecular formula C14H12ClFO2 and a molecular weight of 266.70 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dimethoxyphenyl)-3-fluorobenzene.
| Compound Name | 1-chloro-2-(2,4-dimethoxyphenyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 146431475 |
| Molecular Formula | C14H12ClFO2 |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-chloro-2-(2,4-dimethoxyphenyl)-3-fluorobenzene |
| SMILES | COc1ccc(-c2c(F)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C14H12ClFO2/c1-17-9-6-7-10(13(8-9)18-2)14-11(15)4-3-5-12(14)16/h3-8H,1-2H3 |
| InChIKey | MAUWRCKUVIVOIR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |