C9H9F3OS — CID 130768093
3,5-dimethyl-2-(trifluoromethylsulfanyl)phenol (PubChem CID 130768093) has the molecular formula C9H9F3OS and a molecular weight of 222.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-(trifluoromethylsulfanyl)phenol.
| Compound Name | 3,5-dimethyl-2-(trifluoromethylsulfanyl)phenol |
|---|---|
| PubChem CID | 130768093 |
| Molecular Formula | C9H9F3OS |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 3,5-dimethyl-2-(trifluoromethylsulfanyl)phenol |
| SMILES | Cc1cc(C)c(SC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C9H9F3OS/c1-5-3-6(2)8(7(13)4-5)14-9(10,11)12/h3-4,13H,1-2H3 |
| InChIKey | LIRNFDWNKOVMID-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |