C8H12N2O3 — CID 57195955
4-hydrazinyl-2,6-dimethoxyphenol (PubChem CID 57195955) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-hydrazinyl-2,6-dimethoxyphenol.
| Compound Name | 4-hydrazinyl-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 57195955 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-hydrazinyl-2,6-dimethoxyphenol |
| SMILES | COc1cc(NN)cc(OC)c1O |
| InChI | InChI=1S/C8H12N2O3/c1-12-6-3-5(10-9)4-7(13-2)8(6)11/h3-4,10-11H,9H2,1-2H3 |
| InChIKey | BJXVVPYPAFAROB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|