C27H22O10S2 — CID 59022186
2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid (PubChem CID 59022186) has the molecular formula C27H22O10S2 and a molecular weight of 570.60 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid.
| Compound Name | 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59022186 |
| Molecular Formula | C27H22O10S2 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid |
| SMILES | COc1ccc(Oc2ccc(Oc3ccc(C(=O)c4ccc(C)c(SOOO)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H22O10S2/c1-17-3-4-18(15-25(17)38-37-36-29)27(28)19-5-14-24(26(16-19)39(30,31)32)35-23-12-10-22(11-13-23)34-21-8-6-20(33-2)7-9-21/h3-16,29H,1-2H3,(H,30,31,32) |
| InChIKey | URPRZHXHKYBMTQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|