C53H40O12S2 — CID 58835478
2-[4-(4-methoxyphenyl)phenoxy]-5-[4-[[4-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]phenoxy]methyl]-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid (PubChem CID 58835478) has the molecular formula C53H40O12S2 and a molecular weight of 933.03 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)phenoxy]-5-[4-[[4-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]phenoxy]methyl]-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid.
| Compound Name | 2-[4-(4-methoxyphenyl)phenoxy]-5-[4-[[4-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]phenoxy]methyl]-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58835478 |
| Molecular Formula | C53H40O12S2 |
| Molecular Weight | 933.03 g/mol |
| Exact Mass | 932.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)phenoxy]-5-[4-[[4-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]phenoxy]methyl]-3-(trioxidanylsulfanyl)benzoyl]benzenesulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(C(=O)c4ccc(COc5ccc(-c6ccc(Oc7ccc(C(=O)c8ccc(C)cc8)cc7)cc6)cc5)c(SOOO)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C53H40O12S2/c1-34-3-5-39(6-4-34)52(54)40-17-28-47(29-18-40)62-46-24-13-37(14-25-46)36-11-22-45(23-12-36)61-33-43-8-7-41(31-50(43)66-65-64-56)53(55)42-19-30-49(51(32-42)67(57,58)59)63-48-26-15-38(16-27-48)35-9-20-44(60-2)21-10-35/h3-32,56H,33H2,1-2H3,(H,57,58,59) |
| InChIKey | SBEOIHSIEMFNPT-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.03 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|