C34H28O15S4 — CID 58013337
2-[4-[[4-(4-methoxybenzoyl)phenyl]methoxy]-2-(trioxidanylsulfanyl)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid (PubChem CID 58013337) has the molecular formula C34H28O15S4 and a molecular weight of 804.85 g/mol. Its IUPAC name is 2-[4-[[4-(4-methoxybenzoyl)phenyl]methoxy]-2-(trioxidanylsulfanyl)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 2-[4-[[4-(4-methoxybenzoyl)phenyl]methoxy]-2-(trioxidanylsulfanyl)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58013337 |
| Molecular Formula | C34H28O15S4 |
| Molecular Weight | 804.85 g/mol |
| Exact Mass | 804.03 |
| IUPAC Name | 2-[4-[[4-(4-methoxybenzoyl)phenyl]methoxy]-2-(trioxidanylsulfanyl)phenoxy]-5-[4-methyl-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
| SMILES | COc1ccc(C(=O)c2ccc(COc3ccc(Oc4ccc(S(=O)(=O)c5ccc(C)c(SOOO)c5)cc4S(=O)(=O)O)c(SOOO)c3)cc2)cc1 |
| InChI | InChI=1S/C34H28O15S4/c1-21-3-13-27(18-31(21)50-48-46-36)52(38,39)28-14-16-30(33(19-28)53(40,41)42)45-29-15-12-26(17-32(29)51-49-47-37)44-20-22-4-6-23(7-5-22)34(35)24-8-10-25(43-2)11-9-24/h3-19,36-37H,20H2,1-2H3,(H,40,41,42) |
| InChIKey | FONNOAMYEGQOGN-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 210.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.85 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|