C42H40O19S5 — CID 90704916
methanesulfonic acid;2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylbenzoyl)phenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid (PubChem CID 90704916) has the molecular formula C42H40O19S5 and a molecular weight of 1009.10 g/mol. Its IUPAC name is methanesulfonic acid;2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylbenzoyl)phenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid.
| Compound Name | methanesulfonic acid;2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylbenzoyl)phenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90704916 |
| Molecular Formula | C42H40O19S5 |
| Molecular Weight | 1009.10 g/mol |
| Exact Mass | 1008.08 |
| IUPAC Name | methanesulfonic acid;2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylbenzoyl)phenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
| SMILES | COc1ccc(Oc2ccc(Oc3ccc(S(=O)(=O)c4ccc(COc5ccc(C(=O)c6ccc(C)cc6)cc5)c(SOOO)c4)cc3S(=O)(=O)O)cc2)cc1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C40H32O13S3.2CH4O3S/c1-26-3-5-27(6-4-26)40(41)28-7-10-31(11-8-28)49-25-29-9-20-35(23-38(29)54-53-52-42)55(43,44)36-21-22-37(39(24-36)56(45,46)47)51-34-18-16-33(17-19-34)50-32-14-12-30(48-2)13-15-32;2*1-5(2,3)4/h3-24,42H,25H2,1-2H3,(H,45,46,47);2*1H3,(H,2,3,4) |
| InChIKey | CBRCLASCYRNSRC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 289.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.10 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|