C39H32O14S4 — CID 58854797
2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylphenyl)sulfonylphenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid (PubChem CID 58854797) has the molecular formula C39H32O14S4 and a molecular weight of 852.94 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylphenyl)sulfonylphenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylphenyl)sulfonylphenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58854797 |
| Molecular Formula | C39H32O14S4 |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.07 |
| IUPAC Name | 2-[4-(4-methoxyphenoxy)phenoxy]-5-[4-[[4-(4-methylphenyl)sulfonylphenoxy]methyl]-3-(trioxidanylsulfanyl)phenyl]sulfonylbenzenesulfonic acid |
| SMILES | COc1ccc(Oc2ccc(Oc3ccc(S(=O)(=O)c4ccc(COc5ccc(S(=O)(=O)c6ccc(C)cc6)cc5)c(SOOO)c4)cc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C39H32O14S4/c1-26-3-16-33(17-4-26)55(41,42)34-19-14-29(15-20-34)49-25-27-5-18-35(23-38(27)54-53-52-40)56(43,44)36-21-22-37(39(24-36)57(45,46)47)51-32-12-10-31(11-13-32)50-30-8-6-28(48-2)7-9-30/h3-24,40H,25H2,1-2H3,(H,45,46,47) |
| InChIKey | ONHAEOPUUNFBED-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|