C52H32InN8O10S2 — CID 140583398
CID 140583398 (PubChem CID 140583398) has the molecular formula C52H32InN8O10S2 and a molecular weight of 1107.83 g/mol.
| Compound Name | CID 140583398 |
|---|---|
| PubChem CID | 140583398 |
| Molecular Formula | C52H32InN8O10S2 |
| Molecular Weight | 1107.83 g/mol |
| Exact Mass | 1107.07 |
| IUPAC Name | — |
| SMILES | COc1c2ccccc2c(OC)c2c3n4c(c12)/N=C1\N=C(/N=c2/c5c(OC)c6ccccc6c(OC)c5/c(n2[In]4)=N/C2=N/C(=N\3)c3cc4cc(S(=O)(=O)O)ccc4cc32)c2cc3cc(SOOO)ccc3cc21 |
| InChI | InChI=1S/C52H32N8O10S2.In/c1-65-41-29-9-5-7-11-31(29)43(67-3)39-37(41)50-56-46-34-20-24-14-16-28(72(62,63)64)18-26(24)22-36(34)48(54-46)58-52-40-38(42(66-2)30-10-6-8-12-32(30)44(40)68-4)49(60-52)55-45-33-19-23-13-15-27(71-70-69-61)17-25(23)21-35(33)47(53-45)57-51(39)59-50;/h5-22H,1-4H3,(H2-2,53,54,55,56,57,58,59,60,61,62,63,64);/q-2;+2 |
| InChIKey | DUWHGDPOROUWAW-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 214.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.83 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|