C34H52N2P2+2 — CID 145308814
3-aminopropyl-methyl-[4-[4-[methyl(diphenyl)phosphaniumyl]butyl-phenylphosphanyl]butyl]-propylazanium (PubChem CID 145308814) has the molecular formula C34H52N2P2+2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 3-aminopropyl-methyl-[4-[4-[methyl(diphenyl)phosphaniumyl]butyl-phenylphosphanyl]butyl]-propylazanium.
| Compound Name | 3-aminopropyl-methyl-[4-[4-[methyl(diphenyl)phosphaniumyl]butyl-phenylphosphanyl]butyl]-propylazanium |
|---|---|
| PubChem CID | 145308814 |
| Molecular Formula | C34H52N2P2+2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 3-aminopropyl-methyl-[4-[4-[methyl(diphenyl)phosphaniumyl]butyl-phenylphosphanyl]butyl]-propylazanium |
| SMILES | CCC[N+](C)(CCCN)CCCCP(CCCC[P+](C)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H52N2P2/c1-4-26-36(2,28-18-25-35)27-14-15-29-37(32-19-8-5-9-20-32)30-16-17-31-38(3,33-21-10-6-11-22-33)34-23-12-7-13-24-34/h5-13,19-24H,4,14-18,25-31,35H2,1-3H3/q+2 |
| InChIKey | AHMPKLCCRPRYKU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|