About chromium;ethyl(diphenyl)phosphane
chromium;ethyl(diphenyl)phosphane (PubChem CID 152678584) has the molecular formula C14H14CrP-
and a molecular weight of 265.24 g/mol. Its IUPAC name is chromium;ethyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | chromium;ethyl(diphenyl)phosphane |
| PubChem CID | 152678584 |
| Molecular Formula | C14H14CrP- |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | chromium;ethyl(diphenyl)phosphane |
| SMILES | [CH2-]CP(c1ccccc1)c1ccccc1.[Cr] |
| InChI | InChI=1S/C14H14P.Cr/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12H,1-2H2;/q-1; |
| InChIKey | NRMBFFRNTAEFBV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chromium;ethyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;ethyl(diphenyl)phosphane?
The IUPAC name of chromium;ethyl(diphenyl)phosphane (CID 152678584) is chromium;ethyl(diphenyl)phosphane.
What is the SMILES notation for chromium;ethyl(diphenyl)phosphane?
The canonical SMILES for chromium;ethyl(diphenyl)phosphane is [CH2-]CP(c1ccccc1)c1ccccc1.[Cr].
What is the InChIKey of chromium;ethyl(diphenyl)phosphane?
The InChIKey is NRMBFFRNTAEFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14P.Cr/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12H,1-2H2;/q-1;.
What are the key properties of chromium;ethyl(diphenyl)phosphane?
chromium;ethyl(diphenyl)phosphane has a molecular weight of 265.24 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;ethyl(diphenyl)phosphane is sourced from PubChem (CID 152678584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).