About CID 11228014
CID 11228014 (PubChem CID 11228014) has the molecular formula C37H41IrOP2
and a molecular weight of 755.90 g/mol.
Molecular Properties
| Compound Name | CID 11228014 |
| PubChem CID | 11228014 |
| Molecular Formula | C37H41IrOP2 |
| Molecular Weight | 755.90 g/mol |
| Exact Mass | 756.23 |
| IUPAC Name | — |
| SMILES | CCOC[C]1[C](C)[C](C)[C](C)[C]1C.[Ir].c1ccc(P(CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22P2.C12H19O.Ir/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-6-13-7-12-10(4)8(2)9(3)11(12)5;/h1-20H,21H2;6-7H2,1-5H3; |
| InChIKey | RGVODYZQDYAKNE-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 755.90 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11228014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11228014?
The IUPAC name of CID 11228014 (CID 11228014) is not available.
What is the SMILES notation for CID 11228014?
The canonical SMILES for CID 11228014 is CCOC[C]1[C](C)[C](C)[C](C)[C]1C.[Ir].c1ccc(P(CP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 11228014?
The InChIKey is RGVODYZQDYAKNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22P2.C12H19O.Ir/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25;1-6-13-7-12-10(4)8(2)9(3)11(12)5;/h1-20H,21H2;6-7H2,1-5H3;.
What are the key properties of CID 11228014?
CID 11228014 has a molecular weight of 755.90 g/mol, XLogP of 8.20, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11228014 is sourced from PubChem (CID 11228014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).