About S-(diphenylphosphanylmethyl) iodomethanethioate
S-(diphenylphosphanylmethyl) iodomethanethioate (PubChem CID 126656628) has the molecular formula C14H12IOPS
and a molecular weight of 386.19 g/mol. Its IUPAC name is S-(diphenylphosphanylmethyl) iodomethanethioate.
Molecular Properties
| Compound Name | S-(diphenylphosphanylmethyl) iodomethanethioate |
| PubChem CID | 126656628 |
| Molecular Formula | C14H12IOPS |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | S-(diphenylphosphanylmethyl) iodomethanethioate |
| SMILES | O=C(I)SCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12IOPS/c15-14(16)18-11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | OETPSQBSBNOUSN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(diphenylphosphanylmethyl) iodomethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(diphenylphosphanylmethyl) iodomethanethioate?
The IUPAC name of S-(diphenylphosphanylmethyl) iodomethanethioate (CID 126656628) is S-(diphenylphosphanylmethyl) iodomethanethioate.
What is the SMILES notation for S-(diphenylphosphanylmethyl) iodomethanethioate?
The canonical SMILES for S-(diphenylphosphanylmethyl) iodomethanethioate is O=C(I)SCP(c1ccccc1)c1ccccc1.
What is the InChIKey of S-(diphenylphosphanylmethyl) iodomethanethioate?
The InChIKey is OETPSQBSBNOUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12IOPS/c15-14(16)18-11-17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of S-(diphenylphosphanylmethyl) iodomethanethioate?
S-(diphenylphosphanylmethyl) iodomethanethioate has a molecular weight of 386.19 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(diphenylphosphanylmethyl) iodomethanethioate is sourced from PubChem (CID 126656628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).