About azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate
azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate (PubChem CID 90732147) has the molecular formula C22H29N4O2PS
and a molecular weight of 444.54 g/mol. Its IUPAC name is azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate.
Molecular Properties
| Compound Name | azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate |
| PubChem CID | 90732147 |
| Molecular Formula | C22H29N4O2PS |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate |
| SMILES | CCCNC(=O)CCCC(=O)SCP(c1ccccc1)c1ccccc1.CN=[N+]=[N-] |
| InChI | InChI=1S/C21H26NO2PS.CH3N3/c1-2-16-22-20(23)14-9-15-21(24)26-17-25(18-10-5-3-6-11-18)19-12-7-4-8-13-19;1-3-4-2/h3-8,10-13H,2,9,14-17H2,1H3,(H,22,23);1H3 |
| InChIKey | BCIPSUBUTFECGO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate?
The IUPAC name of azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate (CID 90732147) is azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate.
What is the SMILES notation for azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate?
The canonical SMILES for azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate is CCCNC(=O)CCCC(=O)SCP(c1ccccc1)c1ccccc1.CN=[N+]=[N-].
What is the InChIKey of azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate?
The InChIKey is BCIPSUBUTFECGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26NO2PS.CH3N3/c1-2-16-22-20(23)14-9-15-21(24)26-17-25(18-10-5-3-6-11-18)19-12-7-4-8-13-19;1-3-4-2/h3-8,10-13H,2,9,14-17H2,1H3,(H,22,23);1H3.
What are the key properties of azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate?
azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate has a molecular weight of 444.54 g/mol, XLogP of 4.96, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethane;S-(diphenylphosphanylmethyl) 5-oxo-5-(propylamino)pentanethioate is sourced from PubChem (CID 90732147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).