C26H28NO4PS — CID 15953588
S-[bis(4-methoxyphenyl)phosphanylmethyl] (2S)-2-acetamido-3-phenylpropanethioate (PubChem CID 15953588) has the molecular formula C26H28NO4PS and a molecular weight of 481.55 g/mol. Its IUPAC name is S-[bis(4-methoxyphenyl)phosphanylmethyl] (2S)-2-acetamido-3-phenylpropanethioate.
| Compound Name | S-[bis(4-methoxyphenyl)phosphanylmethyl] (2S)-2-acetamido-3-phenylpropanethioate |
|---|---|
| PubChem CID | 15953588 |
| Molecular Formula | C26H28NO4PS |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | S-[bis(4-methoxyphenyl)phosphanylmethyl] (2S)-2-acetamido-3-phenylpropanethioate |
| SMILES | COc1ccc(P(CSC(=O)[C@H](Cc2ccccc2)NC(C)=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H28NO4PS/c1-19(28)27-25(17-20-7-5-4-6-8-20)26(29)33-18-32(23-13-9-21(30-2)10-14-23)24-15-11-22(31-3)12-16-24/h4-16,25H,17-18H2,1-3H3,(H,27,28)/t25-/m0/s1 |
| InChIKey | UXLHZPXEHUXIDV-VWLOTQADSA-N |
| XLogP | 4.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|