C14H10Cl3OP — CID 12909111
2,2,2-trichloro-1-diphenylphosphanylethanone (PubChem CID 12909111) has the molecular formula C14H10Cl3OP and a molecular weight of 331.57 g/mol. Its IUPAC name is 2,2,2-trichloro-1-diphenylphosphanylethanone.
| Compound Name | 2,2,2-trichloro-1-diphenylphosphanylethanone |
|---|---|
| PubChem CID | 12909111 |
| Molecular Formula | C14H10Cl3OP |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 2,2,2-trichloro-1-diphenylphosphanylethanone |
| SMILES | O=C(P(c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H10Cl3OP/c15-14(16,17)13(18)19(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | FNZCVMZPIFJXEB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|