C24H23Cl2OP — CID 135303084
[3,5-bis(chloromethyl)-2,4,6-trimethylphenyl]-diphenylphosphanylmethanone (PubChem CID 135303084) has the molecular formula C24H23Cl2OP and a molecular weight of 429.33 g/mol. Its IUPAC name is [3,5-bis(chloromethyl)-2,4,6-trimethylphenyl]-diphenylphosphanylmethanone.
| Compound Name | [3,5-bis(chloromethyl)-2,4,6-trimethylphenyl]-diphenylphosphanylmethanone |
|---|---|
| PubChem CID | 135303084 |
| Molecular Formula | C24H23Cl2OP |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [3,5-bis(chloromethyl)-2,4,6-trimethylphenyl]-diphenylphosphanylmethanone |
| SMILES | Cc1c(CCl)c(C)c(C(=O)P(c2ccccc2)c2ccccc2)c(C)c1CCl |
| InChI | InChI=1S/C24H23Cl2OP/c1-16-21(14-25)17(2)23(18(3)22(16)15-26)24(27)28(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13H,14-15H2,1-3H3 |
| InChIKey | YAJRDLXKOWBLHX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|