C17H15ClO4 — CID 150971689
2-(chloromethyl)-4,5-dimethyl-6-phenylbenzene-1,3-dicarboxylic acid (PubChem CID 150971689) has the molecular formula C17H15ClO4 and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-(chloromethyl)-4,5-dimethyl-6-phenylbenzene-1,3-dicarboxylic acid.
| Compound Name | 2-(chloromethyl)-4,5-dimethyl-6-phenylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150971689 |
| Molecular Formula | C17H15ClO4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-(chloromethyl)-4,5-dimethyl-6-phenylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C)c(-c2ccccc2)c(C(=O)O)c(CCl)c1C(=O)O |
| InChI | InChI=1S/C17H15ClO4/c1-9-10(2)14(16(19)20)12(8-18)15(17(21)22)13(9)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | LOFZGUXNBIDFME-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|